C14H16O3 — CID 76832044
ethyl 3-(7-hydroxy-2,3-dihydro-1H-inden-4-yl)prop-2-enoate (PubChem CID 76832044) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is ethyl 3-(7-hydroxy-2,3-dihydro-1H-inden-4-yl)prop-2-enoate.
| Compound Name | ethyl 3-(7-hydroxy-2,3-dihydro-1H-inden-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 76832044 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | ethyl 3-(7-hydroxy-2,3-dihydro-1H-inden-4-yl)prop-2-enoate |
| SMILES | CCOC(=O)C=Cc1ccc(O)c2c1CCC2 |
| InChI | InChI=1S/C14H16O3/c1-2-17-14(16)9-7-10-6-8-13(15)12-5-3-4-11(10)12/h6-9,15H,2-5H2,1H3 |
| InChIKey | FOMGQKKTASTBNA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|