C15H12O5 — CID 1347
5-[2-(2,5-dihydroxyphenyl)ethenyl]-2-hydroxybenzoic acid (PubChem CID 1347) has the molecular formula C15H12O5 and a molecular weight of 272.26 g/mol. Its IUPAC name is 5-[2-(2,5-dihydroxyphenyl)ethenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-(2,5-dihydroxyphenyl)ethenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 1347 |
| Molecular Formula | C15H12O5 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 5-[2-(2,5-dihydroxyphenyl)ethenyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(C=Cc2cc(O)ccc2O)ccc1O |
| InChI | InChI=1S/C15H12O5/c16-11-4-6-13(17)10(8-11)3-1-9-2-5-14(18)12(7-9)15(19)20/h1-8,16-18H,(H,19,20) |
| InChIKey | AYPFKZQQTSLEJG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|