C28H20O6 — CID 54009413
5-[2-[4-[2-(3-carboxy-4-hydroxyphenyl)ethenyl]naphthalen-1-yl]ethenyl]-2-hydroxybenzoic acid (PubChem CID 54009413) has the molecular formula C28H20O6 and a molecular weight of 452.46 g/mol. Its IUPAC name is 5-[2-[4-[2-(3-carboxy-4-hydroxyphenyl)ethenyl]naphthalen-1-yl]ethenyl]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-[4-[2-(3-carboxy-4-hydroxyphenyl)ethenyl]naphthalen-1-yl]ethenyl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 54009413 |
| Molecular Formula | C28H20O6 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 5-[2-[4-[2-(3-carboxy-4-hydroxyphenyl)ethenyl]naphthalen-1-yl]ethenyl]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(C=Cc2ccc(C=Cc3ccc(O)c(C(=O)O)c3)c3ccccc23)ccc1O |
| InChI | InChI=1S/C28H20O6/c29-25-13-7-17(15-23(25)27(31)32)5-9-19-11-12-20(22-4-2-1-3-21(19)22)10-6-18-8-14-26(30)24(16-18)28(33)34/h1-16,29-30H,(H,31,32)(H,33,34) |
| InChIKey | KRFUXUOEOIOEJA-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|