5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid

C17H16O5 — CID 18991498

IUPAC5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid
SMILESCOc1ccc(OC)c(/C=C/c2ccc(O)c(C(=O)O)c2)c1
InChIInChI=1S/C17H16O5/c1-21-13-6-8-16(22-2)12(10-13)5-3-11-4-7-15(18)14(9-11)17(19)20/h3-10,18H,1-2H3,(H,19,20)/b5-3+
InChIKeyJFSMBPOXQCXXDS-HWKANZROSA-N
MW300.31 g/mol
LogP3.28
Rot. Bonds5

About 5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid

5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid (PubChem CID 18991498) has the molecular formula C17H16O5 and a molecular weight of 300.31 g/mol. Its IUPAC name is 5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid.

Molecular Properties

Compound Name5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid
PubChem CID18991498
Molecular FormulaC17H16O5
Molecular Weight300.31 g/mol
Exact Mass300.10
IUPAC Name5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid
SMILESCOc1ccc(OC)c(/C=C/c2ccc(O)c(C(=O)O)c2)c1
InChIInChI=1S/C17H16O5/c1-21-13-6-8-16(22-2)12(10-13)5-3-11-4-7-15(18)14(9-11)17(19)20/h3-10,18H,1-2H3,(H,19,20)/b5-3+
InChIKeyJFSMBPOXQCXXDS-HWKANZROSA-N
XLogP3.28
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.31
LogP ≤ 53.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'stilbene', 'substructure': 'N/A'}

Analyze 5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid?
The IUPAC name of 5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid (CID 18991498) is 5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid.
What is the SMILES notation for 5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid?
The canonical SMILES for 5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid is COc1ccc(OC)c(/C=C/c2ccc(O)c(C(=O)O)c2)c1.
What is the InChIKey of 5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid?
The InChIKey is JFSMBPOXQCXXDS-HWKANZROSA-N. The full InChI is InChI=1S/C17H16O5/c1-21-13-6-8-16(22-2)12(10-13)5-3-11-4-7-15(18)14(9-11)17(19)20/h3-10,18H,1-2H3,(H,19,20)/b5-3+.
What are the key properties of 5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid?
5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid has a molecular weight of 300.31 g/mol, XLogP of 3.28, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzoic acid is sourced from PubChem (CID 18991498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).