C15H15NO2 — CID 144798319
4-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]pyridine (PubChem CID 144798319) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]pyridine.
| Compound Name | 4-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]pyridine |
|---|---|
| PubChem CID | 144798319 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 4-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]pyridine |
| SMILES | COc1ccc(OC)c(/C=C/c2ccncc2)c1 |
| InChI | InChI=1S/C15H15NO2/c1-17-14-5-6-15(18-2)13(11-14)4-3-12-7-9-16-10-8-12/h3-11H,1-2H3/b4-3+ |
| InChIKey | VBBKSLFXSLXZOM-ONEGZZNKSA-N |
| XLogP | 3.27 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |