C16H18INO2 — CID 171668959
4-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide (PubChem CID 171668959) has the molecular formula C16H18INO2 and a molecular weight of 383.23 g/mol. Its IUPAC name is 4-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide.
| Compound Name | 4-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide |
|---|---|
| PubChem CID | 171668959 |
| Molecular Formula | C16H18INO2 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 4-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-1-methylpyridin-1-ium iodide |
| SMILES | COc1ccc(OC)c(/C=C/c2cc[n+](C)cc2)c1.[I-] |
| InChI | InChI=1S/C16H18NO2.HI/c1-17-10-8-13(9-11-17)4-5-14-12-15(18-2)6-7-16(14)19-3;/h4-12H,1-3H3;1H/q+1;/p-1/b5-4+; |
| InChIKey | DDOCPMPGCZLPEW-FXRZFVDSSA-M |
| XLogP | -0.30 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|