C19H19IN2O2 — CID 54601049
4-[(Z)-2-(2,5-dimethoxyphenyl)ethenyl]-1-methylcinnolin-1-ium iodide (PubChem CID 54601049) has the molecular formula C19H19IN2O2 and a molecular weight of 434.28 g/mol. Its IUPAC name is 4-[(Z)-2-(2,5-dimethoxyphenyl)ethenyl]-1-methylcinnolin-1-ium iodide.
| Compound Name | 4-[(Z)-2-(2,5-dimethoxyphenyl)ethenyl]-1-methylcinnolin-1-ium iodide |
|---|---|
| PubChem CID | 54601049 |
| Molecular Formula | C19H19IN2O2 |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 4-[(Z)-2-(2,5-dimethoxyphenyl)ethenyl]-1-methylcinnolin-1-ium iodide |
| SMILES | COc1ccc(OC)c(/C=C\c2cn[n+](C)c3ccccc23)c1.[I-] |
| InChI | InChI=1S/C19H19N2O2.HI/c1-21-18-7-5-4-6-17(18)15(13-20-21)9-8-14-12-16(22-2)10-11-19(14)23-3;/h4-13H,1-3H3;1H/q+1;/p-1/b9-8-; |
| InChIKey | MLSIHAGQBFSCOE-UOQXYWCXSA-M |
| XLogP | 0.25 |
| TPSA | 35.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|