C10H13BO4 — CID 81222718
[(E)-2-(2,5-dimethoxyphenyl)ethenyl]boronic acid (PubChem CID 81222718) has the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. Its IUPAC name is [(E)-2-(2,5-dimethoxyphenyl)ethenyl]boronic acid.
| Compound Name | [(E)-2-(2,5-dimethoxyphenyl)ethenyl]boronic acid |
|---|---|
| PubChem CID | 81222718 |
| Molecular Formula | C10H13BO4 |
| Molecular Weight | 208.02 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | [(E)-2-(2,5-dimethoxyphenyl)ethenyl]boronic acid |
| SMILES | COc1ccc(OC)c(/C=C/B(O)O)c1 |
| InChI | InChI=1S/C10H13BO4/c1-14-9-3-4-10(15-2)8(7-9)5-6-11(12)13/h3-7,12-13H,1-2H3/b6-5+ |
| InChIKey | XOVGFTZLYVRUKN-AATRIKPKSA-N |
| XLogP | 0.73 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.02 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|