C11H14O3 — CID 67174730
1,4-dimethoxy-2-(2-methoxyethenyl)benzene (PubChem CID 67174730) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 1,4-dimethoxy-2-(2-methoxyethenyl)benzene.
| Compound Name | 1,4-dimethoxy-2-(2-methoxyethenyl)benzene |
|---|---|
| PubChem CID | 67174730 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 1,4-dimethoxy-2-(2-methoxyethenyl)benzene |
| SMILES | COC=Cc1cc(OC)ccc1OC |
| InChI | InChI=1S/C11H14O3/c1-12-7-6-9-8-10(13-2)4-5-11(9)14-3/h4-8H,1-3H3 |
| InChIKey | XALBZBJMMJPHRF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|