C10H11IO2 — CID 46839985
2-[(E)-2-iodoethenyl]-1,4-dimethoxybenzene (PubChem CID 46839985) has the molecular formula C10H11IO2 and a molecular weight of 290.10 g/mol. Its IUPAC name is 2-[(E)-2-iodoethenyl]-1,4-dimethoxybenzene.
| Compound Name | 2-[(E)-2-iodoethenyl]-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 46839985 |
| Molecular Formula | C10H11IO2 |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 2-[(E)-2-iodoethenyl]-1,4-dimethoxybenzene |
| SMILES | COc1ccc(OC)c(/C=C/I)c1 |
| InChI | InChI=1S/C10H11IO2/c1-12-9-3-4-10(13-2)8(7-9)5-6-11/h3-7H,1-2H3/b6-5+ |
| InChIKey | QYRGUQDDFINBRL-AATRIKPKSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|