C15H17NO2 — CID 131968427
2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-1-methylpyrrole (PubChem CID 131968427) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-1-methylpyrrole.
| Compound Name | 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-1-methylpyrrole |
|---|---|
| PubChem CID | 131968427 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 2-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]-1-methylpyrrole |
| SMILES | COc1ccc(OC)c(/C=C/c2cccn2C)c1 |
| InChI | InChI=1S/C15H17NO2/c1-16-10-4-5-13(16)7-6-12-11-14(17-2)8-9-15(12)18-3/h4-11H,1-3H3/b7-6+ |
| InChIKey | VBAFEPSGKLNOCY-VOTSOKGWSA-N |
| XLogP | 3.21 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |