C23H18O4 — CID 155523051
4-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]benzo[h]chromen-2-one (PubChem CID 155523051) has the molecular formula C23H18O4 and a molecular weight of 358.39 g/mol. Its IUPAC name is 4-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]benzo[h]chromen-2-one.
| Compound Name | 4-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]benzo[h]chromen-2-one |
|---|---|
| PubChem CID | 155523051 |
| Molecular Formula | C23H18O4 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 4-[(E)-2-(2,5-dimethoxyphenyl)ethenyl]benzo[h]chromen-2-one |
| SMILES | COc1ccc(OC)c(/C=C/c2cc(=O)oc3c2ccc2ccccc23)c1 |
| InChI | InChI=1S/C23H18O4/c1-25-18-10-12-21(26-2)17(13-18)8-7-16-14-22(24)27-23-19-6-4-3-5-15(19)9-11-20(16)23/h3-14H,1-2H3/b8-7+ |
| InChIKey | SEGVYLMPLUEUTL-BQYQJAHWSA-N |
| XLogP | 5.13 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|