C20H18O5 — CID 46845156
4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-7-methoxychromen-2-one (PubChem CID 46845156) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-7-methoxychromen-2-one.
| Compound Name | 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 46845156 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-7-methoxychromen-2-one |
| SMILES | COc1cc(/C=C/c2cc(=O)oc3cc(OC)ccc23)cc(OC)c1 |
| InChI | InChI=1S/C20H18O5/c1-22-15-6-7-18-14(10-20(21)25-19(18)12-15)5-4-13-8-16(23-2)11-17(9-13)24-3/h4-12H,1-3H3/b5-4+ |
| InChIKey | VKOBHYDBWDMYKC-SNAWJCMRSA-N |
| XLogP | 3.99 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|