C28H26O6 — CID 171118238
7-[2-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]ethoxy]-4-methylchromen-2-one (PubChem CID 171118238) has the molecular formula C28H26O6 and a molecular weight of 458.51 g/mol. Its IUPAC name is 7-[2-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]ethoxy]-4-methylchromen-2-one.
| Compound Name | 7-[2-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]ethoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 171118238 |
| Molecular Formula | C28H26O6 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 7-[2-[4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]phenoxy]ethoxy]-4-methylchromen-2-one |
| SMILES | COc1cc(/C=C/c2ccc(OCCOc3ccc4c(C)cc(=O)oc4c3)cc2)cc(OC)c1 |
| InChI | InChI=1S/C28H26O6/c1-19-14-28(29)34-27-18-23(10-11-26(19)27)33-13-12-32-22-8-6-20(7-9-22)4-5-21-15-24(30-2)17-25(16-21)31-3/h4-11,14-18H,12-13H2,1-3H3/b5-4+ |
| InChIKey | UEZUDUZHHMJDGM-SNAWJCMRSA-N |
| XLogP | 5.75 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|