C38H32O9 — CID 171118279
7-[2-[4-[(E)-2-[3-hydroxy-5-[2-(4-methyl-2-oxochromen-7-yl)oxyethoxy]phenyl]ethenyl]phenoxy]ethoxy]-4-methylchromen-2-one (PubChem CID 171118279) has the molecular formula C38H32O9 and a molecular weight of 632.67 g/mol. Its IUPAC name is 7-[2-[4-[(E)-2-[3-hydroxy-5-[2-(4-methyl-2-oxochromen-7-yl)oxyethoxy]phenyl]ethenyl]phenoxy]ethoxy]-4-methylchromen-2-one.
| Compound Name | 7-[2-[4-[(E)-2-[3-hydroxy-5-[2-(4-methyl-2-oxochromen-7-yl)oxyethoxy]phenyl]ethenyl]phenoxy]ethoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 171118279 |
| Molecular Formula | C38H32O9 |
| Molecular Weight | 632.67 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | 7-[2-[4-[(E)-2-[3-hydroxy-5-[2-(4-methyl-2-oxochromen-7-yl)oxyethoxy]phenyl]ethenyl]phenoxy]ethoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCCOc3ccc(/C=C/c4cc(O)cc(OCCOc5ccc6c(C)cc(=O)oc6c5)c4)cc3)ccc12 |
| InChI | InChI=1S/C38H32O9/c1-24-17-37(40)46-35-22-30(9-11-33(24)35)43-14-13-42-29-7-5-26(6-8-29)3-4-27-19-28(39)21-32(20-27)45-16-15-44-31-10-12-34-25(2)18-38(41)47-36(34)23-31/h3-12,17-23,39H,13-16H2,1-2H3/b4-3+ |
| InChIKey | FCIIMPOULALKDX-ONEGZZNKSA-N |
| XLogP | 7.31 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.67 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|