C24H19NO5S — CID 16591388
(4-methyl-2-oxochromen-7-yl) (E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoate (PubChem CID 16591388) has the molecular formula C24H19NO5S and a molecular weight of 433.49 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-7-yl) (E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoate.
| Compound Name | (4-methyl-2-oxochromen-7-yl) (E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 16591388 |
| Molecular Formula | C24H19NO5S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | (4-methyl-2-oxochromen-7-yl) (E)-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoate |
| SMILES | Cc1nc(COc2ccc(/C=C/C(=O)Oc3ccc4c(C)cc(=O)oc4c3)cc2)cs1 |
| InChI | InChI=1S/C24H19NO5S/c1-15-11-24(27)30-22-12-20(8-9-21(15)22)29-23(26)10-5-17-3-6-19(7-4-17)28-13-18-14-31-16(2)25-18/h3-12,14H,13H2,1-2H3/b10-5+ |
| InChIKey | LXKKPLRAQSIMCT-BJMVGYQFSA-N |
| XLogP | 5.06 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|