C23H18O8 — CID 25096975
(4-methyl-2-oxochromen-7-yl) (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate (PubChem CID 25096975) has the molecular formula C23H18O8 and a molecular weight of 422.39 g/mol. Its IUPAC name is (4-methyl-2-oxochromen-7-yl) (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate.
| Compound Name | (4-methyl-2-oxochromen-7-yl) (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 25096975 |
| Molecular Formula | C23H18O8 |
| Molecular Weight | 422.39 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | (4-methyl-2-oxochromen-7-yl) (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate |
| SMILES | CC(=O)Oc1ccc(/C=C/C(=O)Oc2ccc3c(C)cc(=O)oc3c2)cc1OC(C)=O |
| InChI | InChI=1S/C23H18O8/c1-13-10-23(27)31-20-12-17(6-7-18(13)20)30-22(26)9-5-16-4-8-19(28-14(2)24)21(11-16)29-15(3)25/h4-12H,1-3H3/b9-5+ |
| InChIKey | KOJIFCYTGFKMKH-WEVVVXLNSA-N |
| XLogP | 3.57 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|