C19H16O6S — CID 129252386
(4-sulfanylphenyl) (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate (PubChem CID 129252386) has the molecular formula C19H16O6S and a molecular weight of 372.40 g/mol. Its IUPAC name is (4-sulfanylphenyl) (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate.
| Compound Name | (4-sulfanylphenyl) (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 129252386 |
| Molecular Formula | C19H16O6S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (4-sulfanylphenyl) (E)-3-(3,4-diacetyloxyphenyl)prop-2-enoate |
| SMILES | CC(=O)Oc1ccc(/C=C/C(=O)Oc2ccc(S)cc2)cc1OC(C)=O |
| InChI | InChI=1S/C19H16O6S/c1-12(20)23-17-9-3-14(11-18(17)24-13(2)21)4-10-19(22)25-15-5-7-16(26)8-6-15/h3-11,26H,1-2H3/b10-4+ |
| InChIKey | TUAXJAFXDJGANL-ONNFQVAWSA-N |
| XLogP | 3.44 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|