C20H15FO4 — CID 7917069
(4,8-dimethyl-2-oxochromen-7-yl) (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 7917069) has the molecular formula C20H15FO4 and a molecular weight of 338.33 g/mol. Its IUPAC name is (4,8-dimethyl-2-oxochromen-7-yl) (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | (4,8-dimethyl-2-oxochromen-7-yl) (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7917069 |
| Molecular Formula | C20H15FO4 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (4,8-dimethyl-2-oxochromen-7-yl) (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | Cc1cc(=O)oc2c(C)c(OC(=O)/C=C/c3ccc(F)cc3)ccc12 |
| InChI | InChI=1S/C20H15FO4/c1-12-11-19(23)25-20-13(2)17(9-8-16(12)20)24-18(22)10-5-14-3-6-15(21)7-4-14/h3-11H,1-2H3/b10-5+ |
| InChIKey | GBKZWTZQMYVGOC-BJMVGYQFSA-N |
| XLogP | 4.17 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|