C17H15FO2 — CID 6232920
(2,3-dimethylphenyl) (E)-3-(4-fluorophenyl)prop-2-enoate (PubChem CID 6232920) has the molecular formula C17H15FO2 and a molecular weight of 270.30 g/mol. Its IUPAC name is (2,3-dimethylphenyl) (E)-3-(4-fluorophenyl)prop-2-enoate.
| Compound Name | (2,3-dimethylphenyl) (E)-3-(4-fluorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 6232920 |
| Molecular Formula | C17H15FO2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (2,3-dimethylphenyl) (E)-3-(4-fluorophenyl)prop-2-enoate |
| SMILES | Cc1cccc(OC(=O)/C=C/c2ccc(F)cc2)c1C |
| InChI | InChI=1S/C17H15FO2/c1-12-4-3-5-16(13(12)2)20-17(19)11-8-14-6-9-15(18)10-7-14/h3-11H,1-2H3/b11-8+ |
| InChIKey | BJSUESKZKSYNDP-DHZHZOJOSA-N |
| XLogP | 4.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|