C25H20O6 — CID 2482009
(3-oxobenzo[f]chromen-1-yl)methyl (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 2482009) has the molecular formula C25H20O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2482009 |
| Molecular Formula | C25H20O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)OCc2cc(=O)oc3ccc4ccccc4c23)c1 |
| InChI | InChI=1S/C25H20O6/c1-28-19-9-11-21(29-2)17(13-19)8-12-23(26)30-15-18-14-24(27)31-22-10-7-16-5-3-4-6-20(16)25(18)22/h3-14H,15H2,1-2H3/b12-8+ |
| InChIKey | IOPVYDYTRLWZPX-XYOKQWHBSA-N |
| XLogP | 4.72 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|