C25H22O7 — CID 4312941
(3-oxobenzo[f]chromen-1-yl)methyl 2-(3,4,5-trimethoxyphenyl)acetate (PubChem CID 4312941) has the molecular formula C25H22O7 and a molecular weight of 434.44 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 2-(3,4,5-trimethoxyphenyl)acetate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 2-(3,4,5-trimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 4312941 |
| Molecular Formula | C25H22O7 |
| Molecular Weight | 434.44 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 2-(3,4,5-trimethoxyphenyl)acetate |
| SMILES | COc1cc(CC(=O)OCc2cc(=O)oc3ccc4ccccc4c23)cc(OC)c1OC |
| InChI | InChI=1S/C25H22O7/c1-28-20-10-15(11-21(29-2)25(20)30-3)12-22(26)31-14-17-13-23(27)32-19-9-8-16-6-4-5-7-18(16)24(17)19/h4-11,13H,12,14H2,1-3H3 |
| InChIKey | JZPXYIFIJUGGGG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|