C26H20O5 — CID 7251817
(3-oxobenzo[f]chromen-1-yl)methyl 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate (PubChem CID 7251817) has the molecular formula C26H20O5 and a molecular weight of 412.44 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7251817 |
| Molecular Formula | C26H20O5 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate |
| SMILES | Cc1cc2occ(CC(=O)OCc3cc(=O)oc4ccc5ccccc5c34)c2cc1C |
| InChI | InChI=1S/C26H20O5/c1-15-9-21-18(13-29-23(21)10-16(15)2)11-24(27)30-14-19-12-25(28)31-22-8-7-17-5-3-4-6-20(17)26(19)22/h3-10,12-13H,11,14H2,1-2H3 |
| InChIKey | SXSVMBAJVVGSJY-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|