About (3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate
(3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate (PubChem CID 2550404) has the molecular formula C20H14O4S
and a molecular weight of 350.40 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate.
Molecular Properties
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate |
| PubChem CID | 2550404 |
| Molecular Formula | C20H14O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate |
| SMILES | O=C(Cc1ccsc1)OCc1cc(=O)oc2ccc3ccccc3c12 |
| InChI | InChI=1S/C20H14O4S/c21-18(9-13-7-8-25-12-13)23-11-15-10-19(22)24-17-6-5-14-3-1-2-4-16(14)20(15)17/h1-8,10,12H,9,11H2 |
| InChIKey | JLQJWKLZOSDIBO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate?
The IUPAC name of (3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate (CID 2550404) is (3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate.
What is the SMILES notation for (3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate?
The canonical SMILES for (3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate is O=C(Cc1ccsc1)OCc1cc(=O)oc2ccc3ccccc3c12.
What is the InChIKey of (3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate?
The InChIKey is JLQJWKLZOSDIBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14O4S/c21-18(9-13-7-8-25-12-13)23-11-15-10-19(22)24-17-6-5-14-3-1-2-4-16(14)20(15)17/h1-8,10,12H,9,11H2.
What are the key properties of (3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate?
(3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate has a molecular weight of 350.40 g/mol, XLogP of 4.29, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxobenzo[f]chromen-1-yl)methyl 2-thiophen-3-ylacetate is sourced from PubChem (CID 2550404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).