C20H15NO4S — CID 7954620
(3-oxobenzo[f]chromen-1-yl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 7954620) has the molecular formula C20H15NO4S and a molecular weight of 365.41 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 7954620 |
| Molecular Formula | C20H15NO4S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(C)c(C(=O)OCc2cc(=O)oc3ccc4ccccc4c23)s1 |
| InChI | InChI=1S/C20H15NO4S/c1-11-19(26-12(2)21-11)20(23)24-10-14-9-17(22)25-16-8-7-13-5-3-4-6-15(13)18(14)16/h3-9H,10H2,1-2H3 |
| InChIKey | DGPDAOLXHJOVAC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|