C28H16F3NO4S2 — CID 2421046
(3-oxobenzo[f]chromen-1-yl)methyl 3-methyl-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxylate (PubChem CID 2421046) has the molecular formula C28H16F3NO4S2 and a molecular weight of 551.57 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 3-methyl-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 3-methyl-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 2421046 |
| Molecular Formula | C28H16F3NO4S2 |
| Molecular Weight | 551.57 g/mol |
| Exact Mass | 551.05 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 3-methyl-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxylate |
| SMILES | Cc1c(C(=O)OCc2cc(=O)oc3ccc4ccccc4c23)sc2nc(-c3cccs3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C28H16F3NO4S2/c1-14-23-18(28(29,30)31)12-19(21-7-4-10-37-21)32-26(23)38-25(14)27(34)35-13-16-11-22(33)36-20-9-8-15-5-2-3-6-17(15)24(16)20/h2-12H,13H2,1H3 |
| InChIKey | LHASBQZYKNCSLF-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.57 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|