C22H15F4NO3S2 — CID 2408526
2-(4-fluorophenoxy)ethyl 3-methyl-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxylate (PubChem CID 2408526) has the molecular formula C22H15F4NO3S2 and a molecular weight of 481.49 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)ethyl 3-methyl-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxylate.
| Compound Name | 2-(4-fluorophenoxy)ethyl 3-methyl-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 2408526 |
| Molecular Formula | C22H15F4NO3S2 |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | 2-(4-fluorophenoxy)ethyl 3-methyl-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxylate |
| SMILES | Cc1c(C(=O)OCCOc2ccc(F)cc2)sc2nc(-c3cccs3)cc(C(F)(F)F)c12 |
| InChI | InChI=1S/C22H15F4NO3S2/c1-12-18-15(22(24,25)26)11-16(17-3-2-10-31-17)27-20(18)32-19(12)21(28)30-9-8-29-14-6-4-13(23)5-7-14/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | LGLCSGIGORTOPY-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|