C18H18N2O4S — CID 28868337
2-phenoxyethyl 2-ethyl-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 28868337) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-phenoxyethyl 2-ethyl-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-phenoxyethyl 2-ethyl-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 28868337 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 2-phenoxyethyl 2-ethyl-5-methyl-4-oxo-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCc1nc2sc(C(=O)OCCOc3ccccc3)c(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C18H18N2O4S/c1-3-13-19-16(21)14-11(2)15(25-17(14)20-13)18(22)24-10-9-23-12-7-5-4-6-8-12/h4-8H,3,9-10H2,1-2H3,(H,19,20,21) |
| InChIKey | NBVYJVNYLFQLCM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 81.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|