C16H15N3O4S — CID 28888962
2-methoxyethyl 5-methyl-4-oxo-2-pyridin-2-yl-3H-thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 28888962) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is 2-methoxyethyl 5-methyl-4-oxo-2-pyridin-2-yl-3H-thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl 5-methyl-4-oxo-2-pyridin-2-yl-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 28888962 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-methoxyethyl 5-methyl-4-oxo-2-pyridin-2-yl-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)c1sc2nc(-c3ccccn3)[nH]c(=O)c2c1C |
| InChI | InChI=1S/C16H15N3O4S/c1-9-11-14(20)18-13(10-5-3-4-6-17-10)19-15(11)24-12(9)16(21)23-8-7-22-2/h3-6H,7-8H2,1-2H3,(H,18,19,20) |
| InChIKey | OSIFZQQJCTYWTI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|