C21H16N2O3S — CID 28868209
benzyl 5-methyl-4-oxo-2-phenyl-3H-thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 28868209) has the molecular formula C21H16N2O3S and a molecular weight of 376.44 g/mol. Its IUPAC name is benzyl 5-methyl-4-oxo-2-phenyl-3H-thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | benzyl 5-methyl-4-oxo-2-phenyl-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 28868209 |
| Molecular Formula | C21H16N2O3S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | benzyl 5-methyl-4-oxo-2-phenyl-3H-thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | Cc1c(C(=O)OCc2ccccc2)sc2nc(-c3ccccc3)[nH]c(=O)c12 |
| InChI | InChI=1S/C21H16N2O3S/c1-13-16-19(24)22-18(15-10-6-3-7-11-15)23-20(16)27-17(13)21(25)26-12-14-8-4-2-5-9-14/h2-11H,12H2,1H3,(H,22,23,24) |
| InChIKey | XUVDRQCHDMIKOY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |