C27H17FN2O4S — CID 3648430
(3-oxobenzo[f]chromen-1-yl)methyl 1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate (PubChem CID 3648430) has the molecular formula C27H17FN2O4S and a molecular weight of 484.51 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 3648430 |
| Molecular Formula | C27H17FN2O4S |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carboxylate |
| SMILES | Cc1nn(-c2ccc(F)cc2)c2sc(C(=O)OCc3cc(=O)oc4ccc5ccccc5c34)cc12 |
| InChI | InChI=1S/C27H17FN2O4S/c1-15-21-13-23(35-26(21)30(29-15)19-9-7-18(28)8-10-19)27(32)33-14-17-12-24(31)34-22-11-6-16-4-2-3-5-20(16)25(17)22/h2-13H,14H2,1H3 |
| InChIKey | INWKBCSGQSZKNC-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|