About (3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate
(3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate (PubChem CID 3497590) has the molecular formula C23H24O4
and a molecular weight of 364.44 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate.
Molecular Properties
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate |
| PubChem CID | 3497590 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate |
| SMILES | O=C(CCC1CCCCC1)OCc1cc(=O)oc2ccc3ccccc3c12 |
| InChI | InChI=1S/C23H24O4/c24-21(13-10-16-6-2-1-3-7-16)26-15-18-14-22(25)27-20-12-11-17-8-4-5-9-19(17)23(18)20/h4-5,8-9,11-12,14,16H,1-3,6-7,10,13,15H2 |
| InChIKey | OXZZICKDTPLWQA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze (3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate?
The IUPAC name of (3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate (CID 3497590) is (3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate.
What is the SMILES notation for (3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate?
The canonical SMILES for (3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate is O=C(CCC1CCCCC1)OCc1cc(=O)oc2ccc3ccccc3c12.
What is the InChIKey of (3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate?
The InChIKey is OXZZICKDTPLWQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24O4/c24-21(13-10-16-6-2-1-3-7-16)26-15-18-14-22(25)27-20-12-11-17-8-4-5-9-19(17)23(18)20/h4-5,8-9,11-12,14,16H,1-3,6-7,10,13,15H2.
What are the key properties of (3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate?
(3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate has a molecular weight of 364.44 g/mol, XLogP of 5.35, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-oxobenzo[f]chromen-1-yl)methyl 3-cyclohexylpropanoate is sourced from PubChem (CID 3497590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).