C25H28O4 — CID 5140670
(3-oxobenzo[f]chromen-1-yl)methyl 4-tert-butylcyclohexane-1-carboxylate (PubChem CID 5140670) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 4-tert-butylcyclohexane-1-carboxylate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 4-tert-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 5140670 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 4-tert-butylcyclohexane-1-carboxylate |
| SMILES | CC(C)(C)C1CCC(C(=O)OCc2cc(=O)oc3ccc4ccccc4c23)CC1 |
| InChI | InChI=1S/C25H28O4/c1-25(2,3)19-11-8-17(9-12-19)24(27)28-15-18-14-22(26)29-21-13-10-16-6-4-5-7-20(16)23(18)21/h4-7,10,13-14,17,19H,8-9,11-12,15H2,1-3H3 |
| InChIKey | AFTQHTCBIWYWIE-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|