C23H22O4 — CID 7394600
(3-oxobenzo[f]chromen-1-yl)methyl 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 7394600) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is (3-oxobenzo[f]chromen-1-yl)methyl 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | (3-oxobenzo[f]chromen-1-yl)methyl 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 7394600 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (3-oxobenzo[f]chromen-1-yl)methyl 2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | O=C(C[C@@H]1C[C@H]2CC[C@H]1C2)OCc1cc(=O)oc2ccc3ccccc3c12 |
| InChI | InChI=1S/C23H22O4/c24-21(11-17-10-14-5-6-16(17)9-14)26-13-18-12-22(25)27-20-8-7-15-3-1-2-4-19(15)23(18)20/h1-4,7-8,12,14,16-17H,5-6,9-11,13H2/t14-,16-,17-/m0/s1 |
| InChIKey | AAQDJAHOLKXVGF-XIRDDKMYSA-N |
| XLogP | 4.82 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|