C20H21ClO4 — CID 11916745
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate (PubChem CID 11916745) has the molecular formula C20H21ClO4 and a molecular weight of 360.84 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
|---|---|
| PubChem CID | 11916745 |
| Molecular Formula | C20H21ClO4 |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]acetate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)C[C@H]3C[C@H]4CC[C@@H]3C4)c2cc1Cl |
| InChI | InChI=1S/C20H21ClO4/c1-11-4-18-16(9-17(11)21)15(8-20(23)25-18)10-24-19(22)7-14-6-12-2-3-13(14)5-12/h4,8-9,12-14H,2-3,5-7,10H2,1H3/t12-,13+,14+/m0/s1 |
| InChIKey | VNGGYSKSNFNZOV-BFHYXJOUSA-N |
| XLogP | 4.62 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|