C22H22Cl2O4 — CID 7843983
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 7843983) has the molecular formula C22H22Cl2O4 and a molecular weight of 421.32 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 7843983 |
| Molecular Formula | C22H22Cl2O4 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | Cc1cc2oc(=O)cc(COC(=O)C34C[C@@H]5C[C@@H](CC(Cl)(C5)C3)C4)c2cc1Cl |
| InChI | InChI=1S/C22H22Cl2O4/c1-12-2-18-16(5-17(12)23)15(4-19(25)28-18)10-27-20(26)21-6-13-3-14(7-21)9-22(24,8-13)11-21/h2,4-5,13-14H,3,6-11H2,1H3/t13-,14+,21?,22? |
| InChIKey | NWTILKUSCBFROT-NAZSJPOASA-N |
| XLogP | 5.38 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|