C23H26O5 — CID 4688181
(7,8-dimethyl-2-oxochromen-4-yl)methyl 3-hydroxyadamantane-1-carboxylate (PubChem CID 4688181) has the molecular formula C23H26O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-hydroxyadamantane-1-carboxylate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 4688181 |
| Molecular Formula | C23H26O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 3-hydroxyadamantane-1-carboxylate |
| SMILES | Cc1ccc2c(COC(=O)C34CC5CC(CC(O)(C5)C3)C4)cc(=O)oc2c1C |
| InChI | InChI=1S/C23H26O5/c1-13-3-4-18-17(6-19(24)28-20(18)14(13)2)11-27-21(25)22-7-15-5-16(8-22)10-23(26,9-15)12-22/h3-4,6,15-16,26H,5,7-12H2,1-2H3 |
| InChIKey | RGFMFFKORKYRSB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|