C18H20O6S — CID 8736191
(7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(3S)-1,1-dioxothiolan-3-yl]acetate (PubChem CID 8736191) has the molecular formula C18H20O6S and a molecular weight of 364.42 g/mol. Its IUPAC name is (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(3S)-1,1-dioxothiolan-3-yl]acetate.
| Compound Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(3S)-1,1-dioxothiolan-3-yl]acetate |
|---|---|
| PubChem CID | 8736191 |
| Molecular Formula | C18H20O6S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (7,8-dimethyl-2-oxochromen-4-yl)methyl 2-[(3S)-1,1-dioxothiolan-3-yl]acetate |
| SMILES | Cc1ccc2c(COC(=O)C[C@H]3CCS(=O)(=O)C3)cc(=O)oc2c1C |
| InChI | InChI=1S/C18H20O6S/c1-11-3-4-15-14(8-17(20)24-18(15)12(11)2)9-23-16(19)7-13-5-6-25(21,22)10-13/h3-4,8,13H,5-7,9-10H2,1-2H3/t13-/m1/s1 |
| InChIKey | LHHFOWBYAYVYHQ-CYBMUJFWSA-N |
| XLogP | 2.28 |
| TPSA | 90.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|