C11H14O4S2 — CID 95586548
thiophen-2-ylmethyl 2-[(3S)-1,1-dioxothiolan-3-yl]acetate (PubChem CID 95586548) has the molecular formula C11H14O4S2 and a molecular weight of 274.36 g/mol. Its IUPAC name is thiophen-2-ylmethyl 2-[(3S)-1,1-dioxothiolan-3-yl]acetate.
| Compound Name | thiophen-2-ylmethyl 2-[(3S)-1,1-dioxothiolan-3-yl]acetate |
|---|---|
| PubChem CID | 95586548 |
| Molecular Formula | C11H14O4S2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | thiophen-2-ylmethyl 2-[(3S)-1,1-dioxothiolan-3-yl]acetate |
| SMILES | O=C(C[C@H]1CCS(=O)(=O)C1)OCc1cccs1 |
| InChI | InChI=1S/C11H14O4S2/c12-11(15-7-10-2-1-4-16-10)6-9-3-5-17(13,14)8-9/h1-2,4,9H,3,5-8H2/t9-/m1/s1 |
| InChIKey | XGJHGDKPSDLYLV-SECBINFHSA-N |
| XLogP | 1.62 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |