C11H15NO4S2 — CID 54966659
thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate (PubChem CID 54966659) has the molecular formula C11H15NO4S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate.
| Compound Name | thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate |
|---|---|
| PubChem CID | 54966659 |
| Molecular Formula | C11H15NO4S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate |
| SMILES | O=C(CNC1CCS(=O)(=O)C1)OCc1cccs1 |
| InChI | InChI=1S/C11H15NO4S2/c13-11(16-7-10-2-1-4-17-10)6-12-9-3-5-18(14,15)8-9/h1-2,4,9,12H,3,5-8H2 |
| InChIKey | XTOBDIUITCITMA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |