thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate

C11H15NO4S2 — CID 54966659

IUPACthiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate
SMILESO=C(CNC1CCS(=O)(=O)C1)OCc1cccs1
InChIInChI=1S/C11H15NO4S2/c13-11(16-7-10-2-1-4-17-10)6-12-9-3-5-18(14,15)8-9/h1-2,4,9,12H,3,5-8H2
InChIKeyXTOBDIUITCITMA-UHFFFAOYSA-N
MW289.38 g/mol
LogP0.57
Rot. Bonds5

About thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate

thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate (PubChem CID 54966659) has the molecular formula C11H15NO4S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate.

Molecular Properties

Compound Namethiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate
PubChem CID54966659
Molecular FormulaC11H15NO4S2
Molecular Weight289.38 g/mol
Exact Mass289.04
IUPAC Namethiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate
SMILESO=C(CNC1CCS(=O)(=O)C1)OCc1cccs1
InChIInChI=1S/C11H15NO4S2/c13-11(16-7-10-2-1-4-17-10)6-12-9-3-5-18(14,15)8-9/h1-2,4,9,12H,3,5-8H2
InChIKeyXTOBDIUITCITMA-UHFFFAOYSA-N
XLogP0.57
TPSA72.47 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.38
LogP ≤ 50.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate?
The IUPAC name of thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate (CID 54966659) is thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate.
What is the SMILES notation for thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate?
The canonical SMILES for thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate is O=C(CNC1CCS(=O)(=O)C1)OCc1cccs1.
What is the InChIKey of thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate?
The InChIKey is XTOBDIUITCITMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4S2/c13-11(16-7-10-2-1-4-17-10)6-12-9-3-5-18(14,15)8-9/h1-2,4,9,12H,3,5-8H2.
What are the key properties of thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate?
thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate has a molecular weight of 289.38 g/mol, XLogP of 0.57, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for thiophen-2-ylmethyl 2-[(1,1-dioxothiolan-3-yl)amino]acetate is sourced from PubChem (CID 54966659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).