C8H11NO2S2 — CID 83808062
N-(1,1-dioxothiolan-3-yl)thiophen-2-amine (PubChem CID 83808062) has the molecular formula C8H11NO2S2 and a molecular weight of 217.31 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)thiophen-2-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)thiophen-2-amine |
|---|---|
| PubChem CID | 83808062 |
| Molecular Formula | C8H11NO2S2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)thiophen-2-amine |
| SMILES | O=S1(=O)CCC(Nc2cccs2)C1 |
| InChI | InChI=1S/C8H11NO2S2/c10-13(11)5-3-7(6-13)9-8-2-1-4-12-8/h1-2,4,7,9H,3,5-6H2 |
| InChIKey | RMZVAYDOTRUNLS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |