C13H15N3O4S3 — CID 113013654
N-[6-[(1,1-dioxothiolan-3-yl)amino]-3-pyridinyl]thiophene-2-sulfonamide (PubChem CID 113013654) has the molecular formula C13H15N3O4S3 and a molecular weight of 373.48 g/mol. Its IUPAC name is N-[6-[(1,1-dioxothiolan-3-yl)amino]-3-pyridinyl]thiophene-2-sulfonamide.
| Compound Name | N-[6-[(1,1-dioxothiolan-3-yl)amino]-3-pyridinyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113013654 |
| Molecular Formula | C13H15N3O4S3 |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | N-[6-[(1,1-dioxothiolan-3-yl)amino]-3-pyridinyl]thiophene-2-sulfonamide |
| SMILES | O=S1(=O)CCC(Nc2ccc(NS(=O)(=O)c3cccs3)cn2)C1 |
| InChI | InChI=1S/C13H15N3O4S3/c17-22(18)7-5-11(9-22)15-12-4-3-10(8-14-12)16-23(19,20)13-2-1-6-21-13/h1-4,6,8,11,16H,5,7,9H2,(H,14,15) |
| InChIKey | LRHPRUKQUXJMCE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |