C10H13N3O2S3 — CID 31274685
1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(Z)-thiophen-2-ylmethylideneamino]thiourea (PubChem CID 31274685) has the molecular formula C10H13N3O2S3 and a molecular weight of 303.43 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(Z)-thiophen-2-ylmethylideneamino]thiourea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(Z)-thiophen-2-ylmethylideneamino]thiourea |
|---|---|
| PubChem CID | 31274685 |
| Molecular Formula | C10H13N3O2S3 |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(Z)-thiophen-2-ylmethylideneamino]thiourea |
| SMILES | O=S1(=O)CC[C@H](NC(=S)N/N=C\c2cccs2)C1 |
| InChI | InChI=1S/C10H13N3O2S3/c14-18(15)5-3-8(7-18)12-10(16)13-11-6-9-2-1-4-17-9/h1-2,4,6,8H,3,5,7H2,(H2,12,13,16)/b11-6-/t8-/m0/s1 |
| InChIKey | FWIWMCRIQLUIPC-OITNDJBGSA-N |
| XLogP | 0.73 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|