C21H20N6O4S2 — CID 6582911
1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(Z)-[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea (PubChem CID 6582911) has the molecular formula C21H20N6O4S2 and a molecular weight of 484.56 g/mol. Its IUPAC name is 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(Z)-[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea.
| Compound Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(Z)-[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 6582911 |
| Molecular Formula | C21H20N6O4S2 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 1-[(3S)-1,1-dioxothiolan-3-yl]-3-[(Z)-[3-(3-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea |
| SMILES | O=[N+]([O-])c1cccc(-c2nn(-c3ccccc3)cc2/C=N\NC(=S)N[C@H]2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C21H20N6O4S2/c28-27(29)19-8-4-5-15(11-19)20-16(13-26(25-20)18-6-2-1-3-7-18)12-22-24-21(32)23-17-9-10-33(30,31)14-17/h1-8,11-13,17H,9-10,14H2,(H2,23,24,32)/b22-12-/t17-/m0/s1 |
| InChIKey | CEPDNYZBGLJOKT-SLCIXIPPSA-N |
| XLogP | 2.43 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|