C21H21N5O2S2 — CID 5186058
1-(1,1-dioxothiolan-3-yl)-3-[(1,3-diphenylpyrazol-4-yl)methylideneamino]thiourea (PubChem CID 5186058) has the molecular formula C21H21N5O2S2 and a molecular weight of 439.57 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[(1,3-diphenylpyrazol-4-yl)methylideneamino]thiourea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[(1,3-diphenylpyrazol-4-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 5186058 |
| Molecular Formula | C21H21N5O2S2 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[(1,3-diphenylpyrazol-4-yl)methylideneamino]thiourea |
| SMILES | O=S1(=O)CCC(NC(=S)NN=Cc2cn(-c3ccccc3)nc2-c2ccccc2)C1 |
| InChI | InChI=1S/C21H21N5O2S2/c27-30(28)12-11-18(15-30)23-21(29)24-22-13-17-14-26(19-9-5-2-6-10-19)25-20(17)16-7-3-1-4-8-16/h1-10,13-14,18H,11-12,15H2,(H2,23,24,29) |
| InChIKey | HKVHJAUEZIXPMM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|