C12H13Cl2N3O2S2 — CID 2874716
1-[(3,4-dichlorophenyl)methylideneamino]-3-(1,1-dioxothiolan-3-yl)thiourea (PubChem CID 2874716) has the molecular formula C12H13Cl2N3O2S2 and a molecular weight of 366.30 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methylideneamino]-3-(1,1-dioxothiolan-3-yl)thiourea.
| Compound Name | 1-[(3,4-dichlorophenyl)methylideneamino]-3-(1,1-dioxothiolan-3-yl)thiourea |
|---|---|
| PubChem CID | 2874716 |
| Molecular Formula | C12H13Cl2N3O2S2 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methylideneamino]-3-(1,1-dioxothiolan-3-yl)thiourea |
| SMILES | O=S1(=O)CCC(NC(=S)NN=Cc2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C12H13Cl2N3O2S2/c13-10-2-1-8(5-11(10)14)6-15-17-12(20)16-9-3-4-21(18,19)7-9/h1-2,5-6,9H,3-4,7H2,(H2,16,17,20) |
| InChIKey | HJMBIOQFNYONCM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|