C18H21Cl2N3S — CID 4579690
1-(1-adamantyl)-3-[(3,4-dichlorophenyl)methylideneamino]thiourea (PubChem CID 4579690) has the molecular formula C18H21Cl2N3S and a molecular weight of 382.36 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(3,4-dichlorophenyl)methylideneamino]thiourea.
| Compound Name | 1-(1-adamantyl)-3-[(3,4-dichlorophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 4579690 |
| Molecular Formula | C18H21Cl2N3S |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 1-(1-adamantyl)-3-[(3,4-dichlorophenyl)methylideneamino]thiourea |
| SMILES | S=C(NN=Cc1ccc(Cl)c(Cl)c1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H21Cl2N3S/c19-15-2-1-11(6-16(15)20)10-21-23-17(24)22-18-7-12-3-13(8-18)5-14(4-12)9-18/h1-2,6,10,12-14H,3-5,7-9H2,(H2,22,23,24) |
| InChIKey | ZNBIOOGTFNFNQR-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|