C18H22N4O2S — CID 4642225
1-(1-adamantyl)-3-[(4-nitrophenyl)methylideneamino]thiourea (PubChem CID 4642225) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(4-nitrophenyl)methylideneamino]thiourea.
| Compound Name | 1-(1-adamantyl)-3-[(4-nitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 4642225 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-(1-adamantyl)-3-[(4-nitrophenyl)methylideneamino]thiourea |
| SMILES | O=[N+]([O-])c1ccc(C=NNC(=S)NC23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C18H22N4O2S/c23-22(24)16-3-1-12(2-4-16)11-19-21-17(25)20-18-8-13-5-14(9-18)7-15(6-13)10-18/h1-4,11,13-15H,5-10H2,(H2,20,21,25) |
| InChIKey | XRJIACGEOPYMSL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|