C18H22N4O2 — CID 56693486
N'-[(E)-(4-nitrophenyl)methylideneamino]adamantane-1-carboximidamide (PubChem CID 56693486) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N'-[(E)-(4-nitrophenyl)methylideneamino]adamantane-1-carboximidamide.
| Compound Name | N'-[(E)-(4-nitrophenyl)methylideneamino]adamantane-1-carboximidamide |
|---|---|
| PubChem CID | 56693486 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N'-[(E)-(4-nitrophenyl)methylideneamino]adamantane-1-carboximidamide |
| SMILES | N/C(=N\N=C\c1ccc([N+](=O)[O-])cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H22N4O2/c19-17(18-8-13-5-14(9-18)7-15(6-13)10-18)21-20-11-12-1-3-16(4-2-12)22(23)24/h1-4,11,13-15H,5-10H2,(H2,19,21)/b20-11+ |
| InChIKey | UZFDTIZJGPJZTI-RGVLZGJSSA-N |
| XLogP | 3.50 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|