C19H23N3O3 — CID 6990543
(3S,6R)-N-[(Z)-(4-nitrophenyl)methylideneamino]tricyclo[4.3.1.13,8]undecane-1-carboxamide (PubChem CID 6990543) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (3S,6R)-N-[(Z)-(4-nitrophenyl)methylideneamino]tricyclo[4.3.1.13,8]undecane-1-carboxamide.
| Compound Name | (3S,6R)-N-[(Z)-(4-nitrophenyl)methylideneamino]tricyclo[4.3.1.13,8]undecane-1-carboxamide |
|---|---|
| PubChem CID | 6990543 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (3S,6R)-N-[(Z)-(4-nitrophenyl)methylideneamino]tricyclo[4.3.1.13,8]undecane-1-carboxamide |
| SMILES | O=C(N/N=C\c1ccc([N+](=O)[O-])cc1)C12CC3C[C@@H](CC[C@@H](C3)C1)C2 |
| InChI | InChI=1S/C19H23N3O3/c23-18(21-20-12-13-3-5-17(6-4-13)22(24)25)19-9-14-1-2-15(10-19)8-16(7-14)11-19/h3-6,12,14-16H,1-2,7-11H2,(H,21,23)/b20-12-/t14-,15+,16?,19? |
| InChIKey | HDLLTKYVBXHTLK-WQJJEPCVSA-N |
| XLogP | 3.65 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|